C22H22N2O6S — CID 118197350
1-ethyl-2-oxo-N-(3,4,5-trimethoxyphenyl)benzo[cd]indole-6-sulfonamide (PubChem CID 118197350) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 1-ethyl-2-oxo-N-(3,4,5-trimethoxyphenyl)benzo[cd]indole-6-sulfonamide.
| Compound Name | 1-ethyl-2-oxo-N-(3,4,5-trimethoxyphenyl)benzo[cd]indole-6-sulfonamide |
|---|---|
| PubChem CID | 118197350 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1-ethyl-2-oxo-N-(3,4,5-trimethoxyphenyl)benzo[cd]indole-6-sulfonamide |
| SMILES | CCN1C(=O)c2cccc3c(S(=O)(=O)Nc4cc(OC)c(OC)c(OC)c4)ccc1c23 |
| InChI | InChI=1S/C22H22N2O6S/c1-5-24-16-9-10-19(14-7-6-8-15(20(14)16)22(24)25)31(26,27)23-13-11-17(28-2)21(30-4)18(12-13)29-3/h6-12,23H,5H2,1-4H3 |
| InChIKey | MQACGNPEKLMDPR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |