C20H18N2O3S — CID 15944488
N-(3,5-dimethylphenyl)-1-methyl-2-oxobenzo[cd]indole-6-sulfonamide (PubChem CID 15944488) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-1-methyl-2-oxobenzo[cd]indole-6-sulfonamide.
| Compound Name | N-(3,5-dimethylphenyl)-1-methyl-2-oxobenzo[cd]indole-6-sulfonamide |
|---|---|
| PubChem CID | 15944488 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-(3,5-dimethylphenyl)-1-methyl-2-oxobenzo[cd]indole-6-sulfonamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc3c4c(cccc24)C(=O)N3C)c1 |
| InChI | InChI=1S/C20H18N2O3S/c1-12-9-13(2)11-14(10-12)21-26(24,25)18-8-7-17-19-15(18)5-4-6-16(19)20(23)22(17)3/h4-11,21H,1-3H3 |
| InChIKey | YDHURUUHLKXIAJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |