C25H20N2O3S — CID 90670353
1-ethyl-2-oxo-N-(3-phenylphenyl)benzo[cd]indole-6-sulfonamide (PubChem CID 90670353) has the molecular formula C25H20N2O3S and a molecular weight of 428.51 g/mol. Its IUPAC name is 1-ethyl-2-oxo-N-(3-phenylphenyl)benzo[cd]indole-6-sulfonamide.
| Compound Name | 1-ethyl-2-oxo-N-(3-phenylphenyl)benzo[cd]indole-6-sulfonamide |
|---|---|
| PubChem CID | 90670353 |
| Molecular Formula | C25H20N2O3S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-ethyl-2-oxo-N-(3-phenylphenyl)benzo[cd]indole-6-sulfonamide |
| SMILES | CCN1C(=O)c2cccc3c(S(=O)(=O)Nc4cccc(-c5ccccc5)c4)ccc1c23 |
| InChI | InChI=1S/C25H20N2O3S/c1-2-27-22-14-15-23(20-12-7-13-21(24(20)22)25(27)28)31(29,30)26-19-11-6-10-18(16-19)17-8-4-3-5-9-17/h3-16,26H,2H2,1H3 |
| InChIKey | RIHWZRSLZORHBM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |