About 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide
1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide (PubChem CID 15944491) has the molecular formula C22H22N2O3S
and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide.
Molecular Properties
| Compound Name | 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide |
| PubChem CID | 15944491 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide |
| SMILES | CCN1C(=O)c2cccc3c(S(=O)(=O)Nc4c(C)cc(C)cc4C)ccc1c23 |
| InChI | InChI=1S/C22H22N2O3S/c1-5-24-18-9-10-19(16-7-6-8-17(20(16)18)22(24)25)28(26,27)23-21-14(3)11-13(2)12-15(21)4/h6-12,23H,5H2,1-4H3 |
| InChIKey | JJAAXYHAOXAARJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide?
The IUPAC name of 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide (CID 15944491) is 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide.
What is the SMILES notation for 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide?
The canonical SMILES for 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide is CCN1C(=O)c2cccc3c(S(=O)(=O)Nc4c(C)cc(C)cc4C)ccc1c23.
What is the InChIKey of 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide?
The InChIKey is JJAAXYHAOXAARJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O3S/c1-5-24-18-9-10-19(16-7-6-8-17(20(16)18)22(24)25)28(26,27)23-21-14(3)11-13(2)12-15(21)4/h6-12,23H,5H2,1-4H3.
What are the key properties of 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide?
1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide has a molecular weight of 394.50 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-oxo-N-(2,4,6-trimethylphenyl)benzo[cd]indole-6-sulfonamide is sourced from PubChem (CID 15944491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).