C22H19N2O5S- — CID 6966030
(2R)-2-[(1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonylamino]-3-phenylpropanoate (PubChem CID 6966030) has the molecular formula C22H19N2O5S- and a molecular weight of 423.47 g/mol. Its IUPAC name is (2R)-2-[(1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | (2R)-2-[(1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6966030 |
| Molecular Formula | C22H19N2O5S- |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (2R)-2-[(1-ethyl-2-oxobenzo[cd]indol-6-yl)sulfonylamino]-3-phenylpropanoate |
| SMILES | CCN1C(=O)c2cccc3c(S(=O)(=O)N[C@H](Cc4ccccc4)C(=O)[O-])ccc1c23 |
| InChI | InChI=1S/C22H20N2O5S/c1-2-24-18-11-12-19(15-9-6-10-16(20(15)18)21(24)25)30(28,29)23-17(22(26)27)13-14-7-4-3-5-8-14/h3-12,17,23H,2,13H2,1H3,(H,26,27)/p-1/t17-/m1/s1 |
| InChIKey | TXSBMLZDZBAKCN-QGZVFWFLSA-M |
| XLogP | 1.46 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |