C14H13F2NO4 — CID 80727781
butyl 2-(5,6-difluoro-2,3-dioxoindol-1-yl)acetate (PubChem CID 80727781) has the molecular formula C14H13F2NO4 and a molecular weight of 297.26 g/mol. Its IUPAC name is butyl 2-(5,6-difluoro-2,3-dioxoindol-1-yl)acetate.
| Compound Name | butyl 2-(5,6-difluoro-2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 80727781 |
| Molecular Formula | C14H13F2NO4 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | butyl 2-(5,6-difluoro-2,3-dioxoindol-1-yl)acetate |
| SMILES | CCCCOC(=O)CN1C(=O)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C14H13F2NO4/c1-2-3-4-21-12(18)7-17-11-6-10(16)9(15)5-8(11)13(19)14(17)20/h5-6H,2-4,7H2,1H3 |
| InChIKey | OYFFAZUOGCAHJI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|