C15H11F2NO2S — CID 80747613
1-[(5-ethylthiophen-2-yl)methyl]-5,6-difluoroindole-2,3-dione (PubChem CID 80747613) has the molecular formula C15H11F2NO2S and a molecular weight of 307.32 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)methyl]-5,6-difluoroindole-2,3-dione.
| Compound Name | 1-[(5-ethylthiophen-2-yl)methyl]-5,6-difluoroindole-2,3-dione |
|---|---|
| PubChem CID | 80747613 |
| Molecular Formula | C15H11F2NO2S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)methyl]-5,6-difluoroindole-2,3-dione |
| SMILES | CCc1ccc(CN2C(=O)C(=O)c3cc(F)c(F)cc32)s1 |
| InChI | InChI=1S/C15H11F2NO2S/c1-2-8-3-4-9(21-8)7-18-13-6-12(17)11(16)5-10(13)14(19)15(18)20/h3-6H,2,7H2,1H3 |
| InChIKey | XQEMZTQGKSPRPQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|