C12H12F2N2O2 — CID 80759196
5,6-difluoro-1-[3-(methylamino)propyl]indole-2,3-dione (PubChem CID 80759196) has the molecular formula C12H12F2N2O2 and a molecular weight of 254.24 g/mol. Its IUPAC name is 5,6-difluoro-1-[3-(methylamino)propyl]indole-2,3-dione.
| Compound Name | 5,6-difluoro-1-[3-(methylamino)propyl]indole-2,3-dione |
|---|---|
| PubChem CID | 80759196 |
| Molecular Formula | C12H12F2N2O2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5,6-difluoro-1-[3-(methylamino)propyl]indole-2,3-dione |
| SMILES | CNCCCN1C(=O)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C12H12F2N2O2/c1-15-3-2-4-16-10-6-9(14)8(13)5-7(10)11(17)12(16)18/h5-6,15H,2-4H2,1H3 |
| InChIKey | SSJVUCPWVRQHDO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|