C13H15FN2O2 — CID 61387569
1-[3-(ethylamino)propyl]-6-fluoroindole-2,3-dione (PubChem CID 61387569) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 1-[3-(ethylamino)propyl]-6-fluoroindole-2,3-dione.
| Compound Name | 1-[3-(ethylamino)propyl]-6-fluoroindole-2,3-dione |
|---|---|
| PubChem CID | 61387569 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-[3-(ethylamino)propyl]-6-fluoroindole-2,3-dione |
| SMILES | CCNCCCN1C(=O)C(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C13H15FN2O2/c1-2-15-6-3-7-16-11-8-9(14)4-5-10(11)12(17)13(16)18/h4-5,8,15H,2-3,6-7H2,1H3 |
| InChIKey | ACQIBZZBIWFUHX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|