About 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile
6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile (PubChem CID 106712908) has the molecular formula C16H17FN2O2
and a molecular weight of 288.32 g/mol. Its IUPAC name is 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile.
Molecular Properties
| Compound Name | 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile |
| PubChem CID | 106712908 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCN1C(=O)C(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C16H17FN2O2/c1-16(2,10-18)7-3-4-8-19-13-9-11(17)5-6-12(13)14(20)15(19)21/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | NVSLCKNDZZKRCI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile?
The IUPAC name of 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile (CID 106712908) is 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile.
What is the SMILES notation for 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile?
The canonical SMILES for 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile is CC(C)(C#N)CCCCN1C(=O)C(=O)c2ccc(F)cc21.
What is the InChIKey of 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile?
The InChIKey is NVSLCKNDZZKRCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O2/c1-16(2,10-18)7-3-4-8-19-13-9-11(17)5-6-12(13)14(20)15(19)21/h5-6,9H,3-4,7-8H2,1-2H3.
What are the key properties of 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile?
6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile has a molecular weight of 288.32 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile is sourced from PubChem (CID 106712908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).