C13H14FNO3 — CID 79361539
6-fluoro-1-(3-hydroxy-3-methylbutyl)indole-2,3-dione (PubChem CID 79361539) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is 6-fluoro-1-(3-hydroxy-3-methylbutyl)indole-2,3-dione.
| Compound Name | 6-fluoro-1-(3-hydroxy-3-methylbutyl)indole-2,3-dione |
|---|---|
| PubChem CID | 79361539 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 6-fluoro-1-(3-hydroxy-3-methylbutyl)indole-2,3-dione |
| SMILES | CC(C)(O)CCN1C(=O)C(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C13H14FNO3/c1-13(2,18)5-6-15-10-7-8(14)3-4-9(10)11(16)12(15)17/h3-4,7,18H,5-6H2,1-2H3 |
| InChIKey | XZCXUTOWQLLOAR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|