C16H17BrN2O2 — CID 106712913
6-(7-bromo-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile (PubChem CID 106712913) has the molecular formula C16H17BrN2O2 and a molecular weight of 349.23 g/mol. Its IUPAC name is 6-(7-bromo-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(7-bromo-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106712913 |
| Molecular Formula | C16H17BrN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 6-(7-bromo-2,3-dioxoindol-1-yl)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCN1C(=O)C(=O)c2cccc(Br)c21 |
| InChI | InChI=1S/C16H17BrN2O2/c1-16(2,10-18)8-3-4-9-19-13-11(14(20)15(19)21)6-5-7-12(13)17/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | PFAUDDRPXWSPNU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|