C13H14BrNO2 — CID 61356330
7-bromo-1-pentylindole-2,3-dione (PubChem CID 61356330) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is 7-bromo-1-pentylindole-2,3-dione.
| Compound Name | 7-bromo-1-pentylindole-2,3-dione |
|---|---|
| PubChem CID | 61356330 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 7-bromo-1-pentylindole-2,3-dione |
| SMILES | CCCCCN1C(=O)C(=O)c2cccc(Br)c21 |
| InChI | InChI=1S/C13H14BrNO2/c1-2-3-4-8-15-11-9(12(16)13(15)17)6-5-7-10(11)14/h5-7H,2-4,8H2,1H3 |
| InChIKey | HBYFDWZGMPFSGN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|