C16H19Br2NO2 — CID 4730303
5,7-dibromo-1-octylindole-2,3-dione (PubChem CID 4730303) has the molecular formula C16H19Br2NO2 and a molecular weight of 417.14 g/mol. Its IUPAC name is 5,7-dibromo-1-octylindole-2,3-dione.
| Compound Name | 5,7-dibromo-1-octylindole-2,3-dione |
|---|---|
| PubChem CID | 4730303 |
| Molecular Formula | C16H19Br2NO2 |
| Molecular Weight | 417.14 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | 5,7-dibromo-1-octylindole-2,3-dione |
| SMILES | CCCCCCCCN1C(=O)C(=O)c2cc(Br)cc(Br)c21 |
| InChI | InChI=1S/C16H19Br2NO2/c1-2-3-4-5-6-7-8-19-14-12(15(20)16(19)21)9-11(17)10-13(14)18/h9-10H,2-8H2,1H3 |
| InChIKey | RWCDLSMXNWCUKF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.14 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|