C11H7Br2NO4 — CID 4730340
methyl 2-(5,7-dibromo-2,3-dioxoindol-1-yl)acetate (PubChem CID 4730340) has the molecular formula C11H7Br2NO4 and a molecular weight of 376.99 g/mol. Its IUPAC name is methyl 2-(5,7-dibromo-2,3-dioxoindol-1-yl)acetate.
| Compound Name | methyl 2-(5,7-dibromo-2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 4730340 |
| Molecular Formula | C11H7Br2NO4 |
| Molecular Weight | 376.99 g/mol |
| Exact Mass | 374.87 |
| IUPAC Name | methyl 2-(5,7-dibromo-2,3-dioxoindol-1-yl)acetate |
| SMILES | COC(=O)CN1C(=O)C(=O)c2cc(Br)cc(Br)c21 |
| InChI | InChI=1S/C11H7Br2NO4/c1-18-8(15)4-14-9-6(10(16)11(14)17)2-5(12)3-7(9)13/h2-3H,4H2,1H3 |
| InChIKey | LQYYRLIEJZHTFY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.99 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|