C11H9NO6 — CID 11368729
methyl 2-(5,6-dihydroxy-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 11368729) has the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. Its IUPAC name is methyl 2-(5,6-dihydroxy-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | methyl 2-(5,6-dihydroxy-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 11368729 |
| Molecular Formula | C11H9NO6 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | methyl 2-(5,6-dihydroxy-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | COC(=O)CN1C(=O)c2cc(O)c(O)cc2C1=O |
| InChI | InChI=1S/C11H9NO6/c1-18-9(15)4-12-10(16)5-2-7(13)8(14)3-6(5)11(12)17/h2-3,13-14H,4H2,1H3 |
| InChIKey | WHPNRDFEYODANQ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|