C30H32N2O8 — CID 101160848
methyl 6-[5-[2-(6-methoxy-6-oxohexyl)-1,3-dioxoisoindol-5-yl]-1,3-dioxoisoindol-2-yl]hexanoate (PubChem CID 101160848) has the molecular formula C30H32N2O8 and a molecular weight of 548.59 g/mol. Its IUPAC name is methyl 6-[5-[2-(6-methoxy-6-oxohexyl)-1,3-dioxoisoindol-5-yl]-1,3-dioxoisoindol-2-yl]hexanoate.
| Compound Name | methyl 6-[5-[2-(6-methoxy-6-oxohexyl)-1,3-dioxoisoindol-5-yl]-1,3-dioxoisoindol-2-yl]hexanoate |
|---|---|
| PubChem CID | 101160848 |
| Molecular Formula | C30H32N2O8 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | methyl 6-[5-[2-(6-methoxy-6-oxohexyl)-1,3-dioxoisoindol-5-yl]-1,3-dioxoisoindol-2-yl]hexanoate |
| SMILES | COC(=O)CCCCCN1C(=O)c2ccc(-c3ccc4c(c3)C(=O)N(CCCCCC(=O)OC)C4=O)cc2C1=O |
| InChI | InChI=1S/C30H32N2O8/c1-39-25(33)9-5-3-7-15-31-27(35)21-13-11-19(17-23(21)29(31)37)20-12-14-22-24(18-20)30(38)32(28(22)36)16-8-4-6-10-26(34)40-2/h11-14,17-18H,3-10,15-16H2,1-2H3 |
| InChIKey | KSGVRIHTLQUEJG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|