methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate

C13H12ClNO4 — CID 55138801

IUPACmethyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate
SMILESCOC(=O)CCCN1C(=O)C(=O)c2ccc(Cl)cc21
InChIInChI=1S/C13H12ClNO4/c1-19-11(16)3-2-6-15-10-7-8(14)4-5-9(10)12(17)13(15)18/h4-5,7H,2-3,6H2,1H3
InChIKeyJFRRNFIHKXEWBJ-UHFFFAOYSA-N
MW281.69 g/mol
LogP1.82
Rot. Bonds4

About methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate

methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate (PubChem CID 55138801) has the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. Its IUPAC name is methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate.

Molecular Properties

Compound Namemethyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate
PubChem CID55138801
Molecular FormulaC13H12ClNO4
Molecular Weight281.69 g/mol
Exact Mass281.05
IUPAC Namemethyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate
SMILESCOC(=O)CCCN1C(=O)C(=O)c2ccc(Cl)cc21
InChIInChI=1S/C13H12ClNO4/c1-19-11(16)3-2-6-15-10-7-8(14)4-5-9(10)12(17)13(15)18/h4-5,7H,2-3,6H2,1H3
InChIKeyJFRRNFIHKXEWBJ-UHFFFAOYSA-N
XLogP1.82
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.69
LogP ≤ 51.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate?
The IUPAC name of methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate (CID 55138801) is methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate.
What is the SMILES notation for methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate?
The canonical SMILES for methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate is COC(=O)CCCN1C(=O)C(=O)c2ccc(Cl)cc21.
What is the InChIKey of methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate?
The InChIKey is JFRRNFIHKXEWBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO4/c1-19-11(16)3-2-6-15-10-7-8(14)4-5-9(10)12(17)13(15)18/h4-5,7H,2-3,6H2,1H3.
What are the key properties of methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate?
methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate has a molecular weight of 281.69 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate is sourced from PubChem (CID 55138801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).