C13H12ClNO4 — CID 55138801
methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate (PubChem CID 55138801) has the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. Its IUPAC name is methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate.
| Compound Name | methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate |
|---|---|
| PubChem CID | 55138801 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | methyl 4-(6-chloro-2,3-dioxoindol-1-yl)butanoate |
| SMILES | COC(=O)CCCN1C(=O)C(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H12ClNO4/c1-19-11(16)3-2-6-15-10-7-8(14)4-5-9(10)12(17)13(15)18/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | JFRRNFIHKXEWBJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|