C15H16ClNO2 — CID 107007431
6-chloro-1-hept-6-enylindole-2,3-dione (PubChem CID 107007431) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 6-chloro-1-hept-6-enylindole-2,3-dione.
| Compound Name | 6-chloro-1-hept-6-enylindole-2,3-dione |
|---|---|
| PubChem CID | 107007431 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 6-chloro-1-hept-6-enylindole-2,3-dione |
| SMILES | C=CCCCCCN1C(=O)C(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H16ClNO2/c1-2-3-4-5-6-9-17-13-10-11(16)7-8-12(13)14(18)15(17)19/h2,7-8,10H,1,3-6,9H2 |
| InChIKey | KFEUPQBATDDHTC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|