C14H15ClN2O3 — CID 61354619
6-chloro-1-(2-morpholin-4-ylethyl)indole-2,3-dione (PubChem CID 61354619) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 6-chloro-1-(2-morpholin-4-ylethyl)indole-2,3-dione.
| Compound Name | 6-chloro-1-(2-morpholin-4-ylethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 61354619 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 6-chloro-1-(2-morpholin-4-ylethyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCN2CCOCC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H15ClN2O3/c15-10-1-2-11-12(9-10)17(14(19)13(11)18)4-3-16-5-7-20-8-6-16/h1-2,9H,3-8H2 |
| InChIKey | PWNAOGVYHMTKIN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|