C32H36Cl2N8O4PtS4 — CID 141477274
bis((E)-[(E)-[5-chloro-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]hydrazinylidene]-methylsulfanyl-sulfidomethane);platinum(2+) (PubChem CID 141477274) has the molecular formula C32H36Cl2N8O4PtS4 and a molecular weight of 990.94 g/mol. Its IUPAC name is bis((E)-[(E)-[5-chloro-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]hydrazinylidene]-methylsulfanyl-sulfidomethane);platinum(2+).
| Compound Name | bis((E)-[(E)-[5-chloro-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]hydrazinylidene]-methylsulfanyl-sulfidomethane);platinum(2+) |
|---|---|
| PubChem CID | 141477274 |
| Molecular Formula | C32H36Cl2N8O4PtS4 |
| Molecular Weight | 990.94 g/mol |
| Exact Mass | 989.08 |
| IUPAC Name | bis((E)-[(E)-[5-chloro-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]hydrazinylidene]-methylsulfanyl-sulfidomethane);platinum(2+) |
| SMILES | CS/C([S-])=N/N=C1/C(=O)N(CCN2CCOCC2)c2ccc(Cl)cc21.CS/C([S-])=N/N=C1/C(=O)N(CCN2CCOCC2)c2ccc(Cl)cc21.[Pt+2] |
| InChI | InChI=1S/2C16H19ClN4O2S2.Pt/c2*1-25-16(24)19-18-14-12-10-11(17)2-3-13(12)21(15(14)22)5-4-20-6-8-23-9-7-20;/h2*2-3,10H,4-9H2,1H3,(H,19,24);/q;;+2/p-2/b2*18-14+; |
| InChIKey | IOBCMNDMLCLVLC-UNNDGHNTSA-L |
| XLogP | 3.98 |
| TPSA | 115.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.94 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|