C18H22ClN3O2Se — CID 168858795
5-[(4-chlorophenyl)methylidene]-1-methyl-3-(3-morpholin-4-ylpropyl)-2-selanylideneimidazolidin-4-one (PubChem CID 168858795) has the molecular formula C18H22ClN3O2Se and a molecular weight of 426.81 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylidene]-1-methyl-3-(3-morpholin-4-ylpropyl)-2-selanylideneimidazolidin-4-one.
| Compound Name | 5-[(4-chlorophenyl)methylidene]-1-methyl-3-(3-morpholin-4-ylpropyl)-2-selanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 168858795 |
| Molecular Formula | C18H22ClN3O2Se |
| Molecular Weight | 426.81 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 5-[(4-chlorophenyl)methylidene]-1-methyl-3-(3-morpholin-4-ylpropyl)-2-selanylideneimidazolidin-4-one |
| SMILES | CN1C(=[Se])N(CCCN2CCOCC2)C(=O)C1=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClN3O2Se/c1-20-16(13-14-3-5-15(19)6-4-14)17(23)22(18(20)25)8-2-7-21-9-11-24-12-10-21/h3-6,13H,2,7-12H2,1H3 |
| InChIKey | JFNWJRUNJMFWRD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.81 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|