C25H34ClN3O9 — CID 24840227
bis((Z)-but-2-enedioic acid);4-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]morpholine (PubChem CID 24840227) has the molecular formula C25H34ClN3O9 and a molecular weight of 556.01 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);4-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]morpholine.
| Compound Name | bis((Z)-but-2-enedioic acid);4-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]morpholine |
|---|---|
| PubChem CID | 24840227 |
| Molecular Formula | C25H34ClN3O9 |
| Molecular Weight | 556.01 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);4-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]morpholine |
| SMILES | Clc1ccc(N2CCN(CCCN3CCOCC3)CC2)cc1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H26ClN3O.2C4H4O4/c18-16-2-4-17(5-3-16)21-10-8-19(9-11-21)6-1-7-20-12-14-22-15-13-20;2*5-3(6)1-2-4(7)8/h2-5H,1,6-15H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | SCVIPPHWQRWIFB-SPIKMXEPSA-N |
| XLogP | 1.61 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.01 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|