C18H28ClN3O2 — CID 70730770
4-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-1,4-oxazepan-6-ol (PubChem CID 70730770) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 4-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-1,4-oxazepan-6-ol.
| Compound Name | 4-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 70730770 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 4-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-1,4-oxazepan-6-ol |
| SMILES | OC1COCCN(CCCN2CCN(c3cccc(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C18H28ClN3O2/c19-16-3-1-4-17(13-16)22-9-7-20(8-10-22)5-2-6-21-11-12-24-15-18(23)14-21/h1,3-4,13,18,23H,2,5-12,14-15H2 |
| InChIKey | LOUFUXFCEDKGHT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |