C24H33ClN2O2 — CID 10621874
3-[4-(3-chlorophenyl)piperazin-1-yl]propyl adamantane-1-carboxylate (PubChem CID 10621874) has the molecular formula C24H33ClN2O2 and a molecular weight of 416.99 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]propyl adamantane-1-carboxylate.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]propyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 10621874 |
| Molecular Formula | C24H33ClN2O2 |
| Molecular Weight | 416.99 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]propyl adamantane-1-carboxylate |
| SMILES | O=C(OCCCN1CCN(c2cccc(Cl)c2)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H33ClN2O2/c25-21-3-1-4-22(14-21)27-8-6-26(7-9-27)5-2-10-29-23(28)24-15-18-11-19(16-24)13-20(12-18)17-24/h1,3-4,14,18-20H,2,5-13,15-17H2 |
| InChIKey | FXVRQWNNZOUXJS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.99 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|