C18H28ClN3O — CID 131905298
[1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]pyrrolidin-3-yl]methanol (PubChem CID 131905298) has the molecular formula C18H28ClN3O and a molecular weight of 337.89 g/mol. Its IUPAC name is [1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]pyrrolidin-3-yl]methanol.
| Compound Name | [1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 131905298 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]pyrrolidin-3-yl]methanol |
| SMILES | OCC1CCN(CCCN2CCN(c3cccc(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C18H28ClN3O/c19-17-3-1-4-18(13-17)22-11-9-20(10-12-22)6-2-7-21-8-5-16(14-21)15-23/h1,3-4,13,16,23H,2,5-12,14-15H2 |
| InChIKey | ZFUFFKNYLMOJJB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |