C18H20ClN3O3S2 — CID 162395738
2-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 162395738) has the molecular formula C18H20ClN3O3S2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 2-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 162395738 |
| Molecular Formula | C18H20ClN3O3S2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccc(Cl)cc2)SC1=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H20ClN3O3S2/c19-14-3-1-13(2-4-14)11-15-17(24)22(18(26)27-15)12-16(23)20-5-6-21-7-9-25-10-8-21/h1-4,11H,5-10,12H2,(H,20,23)/b15-11- |
| InChIKey | IJJPMQHAZUBBMV-PTNGSMBKSA-N |
| XLogP | 1.99 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|