C18H21N3O4S2 — CID 6201735
2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-morpholin-4-ylacetamide (PubChem CID 6201735) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-morpholin-4-ylacetamide.
| Compound Name | 2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 6201735 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-morpholin-4-ylacetamide |
| SMILES | CCOc1ccc(/C=C2\SC(=S)N(CC(=O)NN3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-2-25-14-5-3-13(4-6-14)11-15-17(23)21(18(26)27-15)12-16(22)19-20-7-9-24-10-8-20/h3-6,11H,2,7-10,12H2,1H3,(H,19,22)/b15-11- |
| InChIKey | YGCYGKKZRGULDP-PTNGSMBKSA-N |
| XLogP | 1.65 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|