C21H18BrN3O4S2 — CID 4756768
4-bromo-N'-[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]benzohydrazide (PubChem CID 4756768) has the molecular formula C21H18BrN3O4S2 and a molecular weight of 520.43 g/mol. Its IUPAC name is 4-bromo-N'-[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 4756768 |
| Molecular Formula | C21H18BrN3O4S2 |
| Molecular Weight | 520.43 g/mol |
| Exact Mass | 518.99 |
| IUPAC Name | 4-bromo-N'-[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]benzohydrazide |
| SMILES | CCOc1ccc(C=C2SC(=S)N(CC(=O)NNC(=O)c3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H18BrN3O4S2/c1-2-29-16-9-3-13(4-10-16)11-17-20(28)25(21(30)31-17)12-18(26)23-24-19(27)14-5-7-15(22)8-6-14/h3-11H,2,12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | BINGFTOWZYIUPX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|