C21H18N4O6S2 — CID 4756806
N'-[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-2-nitrobenzohydrazide (PubChem CID 4756806) has the molecular formula C21H18N4O6S2 and a molecular weight of 486.53 g/mol. Its IUPAC name is N'-[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-2-nitrobenzohydrazide.
| Compound Name | N'-[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 4756806 |
| Molecular Formula | C21H18N4O6S2 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | N'-[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-2-nitrobenzohydrazide |
| SMILES | CCOc1ccc(C=C2SC(=S)N(CC(=O)NNC(=O)c3ccccc3[N+](=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C21H18N4O6S2/c1-2-31-14-9-7-13(8-10-14)11-17-20(28)24(21(32)33-17)12-18(26)22-23-19(27)15-5-3-4-6-16(15)25(29)30/h3-11H,2,12H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | KTNSMSIYYFFPIU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|