C21H21N3O5S3 — CID 4756788
2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-(4-methylphenyl)sulfonylacetohydrazide (PubChem CID 4756788) has the molecular formula C21H21N3O5S3 and a molecular weight of 491.62 g/mol. Its IUPAC name is 2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-(4-methylphenyl)sulfonylacetohydrazide.
| Compound Name | 2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-(4-methylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 4756788 |
| Molecular Formula | C21H21N3O5S3 |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-(4-methylphenyl)sulfonylacetohydrazide |
| SMILES | CCOc1ccc(C=C2SC(=S)N(CC(=O)NNS(=O)(=O)c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H21N3O5S3/c1-3-29-16-8-6-15(7-9-16)12-18-20(26)24(21(30)31-18)13-19(25)22-23-32(27,28)17-10-4-14(2)5-11-17/h4-12,23H,3,13H2,1-2H3,(H,22,25) |
| InChIKey | MXOCOZPOXAJEBA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|