C20H19N3O4S3 — CID 4762443
N'-(benzenesulfonyl)-3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide (PubChem CID 4762443) has the molecular formula C20H19N3O4S3 and a molecular weight of 461.59 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide.
| Compound Name | N'-(benzenesulfonyl)-3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide |
|---|---|
| PubChem CID | 4762443 |
| Molecular Formula | C20H19N3O4S3 |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N'-(benzenesulfonyl)-3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide |
| SMILES | Cc1ccc(C=C2SC(=S)N(CCC(=O)NNS(=O)(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H19N3O4S3/c1-14-7-9-15(10-8-14)13-17-19(25)23(20(28)29-17)12-11-18(24)21-22-30(26,27)16-5-3-2-4-6-16/h2-10,13,22H,11-12H2,1H3,(H,21,24) |
| InChIKey | QTWLGPMQGKOXPQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|