C15H17NO4 — CID 62023099
6-methoxy-1-(5-oxohexyl)indole-2,3-dione (PubChem CID 62023099) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 6-methoxy-1-(5-oxohexyl)indole-2,3-dione.
| Compound Name | 6-methoxy-1-(5-oxohexyl)indole-2,3-dione |
|---|---|
| PubChem CID | 62023099 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 6-methoxy-1-(5-oxohexyl)indole-2,3-dione |
| SMILES | COc1ccc2c(c1)N(CCCCC(C)=O)C(=O)C2=O |
| InChI | InChI=1S/C15H17NO4/c1-10(17)5-3-4-8-16-13-9-11(20-2)6-7-12(13)14(18)15(16)19/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | ANTRBYBBRKYZAE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|