C13H12ClNO3 — CID 106438767
1-[(E)-3-chloro-2-methylprop-2-enyl]-6-methoxyindole-2,3-dione (PubChem CID 106438767) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is 1-[(E)-3-chloro-2-methylprop-2-enyl]-6-methoxyindole-2,3-dione.
| Compound Name | 1-[(E)-3-chloro-2-methylprop-2-enyl]-6-methoxyindole-2,3-dione |
|---|---|
| PubChem CID | 106438767 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 1-[(E)-3-chloro-2-methylprop-2-enyl]-6-methoxyindole-2,3-dione |
| SMILES | COc1ccc2c(c1)N(C/C(C)=C/Cl)C(=O)C2=O |
| InChI | InChI=1S/C13H12ClNO3/c1-8(6-14)7-15-11-5-9(18-2)3-4-10(11)12(16)13(15)17/h3-6H,7H2,1-2H3/b8-6+ |
| InChIKey | FHDRLUWIZLJBHA-SOFGYWHQSA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|