C25H30N2O6S — CID 594753
methyl 6-[3-(1,3-dioxoisoindol-2-yl)propyl-(4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 594753) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is methyl 6-[3-(1,3-dioxoisoindol-2-yl)propyl-(4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | methyl 6-[3-(1,3-dioxoisoindol-2-yl)propyl-(4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 594753 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | methyl 6-[3-(1,3-dioxoisoindol-2-yl)propyl-(4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | COC(=O)CCCCCN(CCCN1C(=O)c2ccccc2C1=O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H30N2O6S/c1-19-12-14-20(15-13-19)34(31,32)26(16-7-3-4-11-23(28)33-2)17-8-18-27-24(29)21-9-5-6-10-22(21)25(27)30/h5-6,9-10,12-15H,3-4,7-8,11,16-18H2,1-2H3 |
| InChIKey | BQRGVSCHZMSFDS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|