C23H28N2O7S2 — CID 19860702
3-[4-(1,3-dioxoisoindol-2-yl)butyl-(4-methylphenyl)sulfonylamino]propyl methanesulfonate (PubChem CID 19860702) has the molecular formula C23H28N2O7S2 and a molecular weight of 508.62 g/mol. Its IUPAC name is 3-[4-(1,3-dioxoisoindol-2-yl)butyl-(4-methylphenyl)sulfonylamino]propyl methanesulfonate.
| Compound Name | 3-[4-(1,3-dioxoisoindol-2-yl)butyl-(4-methylphenyl)sulfonylamino]propyl methanesulfonate |
|---|---|
| PubChem CID | 19860702 |
| Molecular Formula | C23H28N2O7S2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 3-[4-(1,3-dioxoisoindol-2-yl)butyl-(4-methylphenyl)sulfonylamino]propyl methanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCCN2C(=O)c3ccccc3C2=O)CCCOS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H28N2O7S2/c1-18-10-12-19(13-11-18)34(30,31)24(15-7-17-32-33(2,28)29)14-5-6-16-25-22(26)20-8-3-4-9-21(20)23(25)27/h3-4,8-13H,5-7,14-17H2,1-2H3 |
| InChIKey | LEGUTBDQLMKFFF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|