About 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate
4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate (PubChem CID 31437953) has the molecular formula C21H21FN2O6S
and a molecular weight of 448.47 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate.
Molecular Properties
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate |
| PubChem CID | 31437953 |
| Molecular Formula | C21H21FN2O6S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OCCCCN1C(=O)c2ccccc2C1=O)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2O6S/c1-23(31(28,29)16-10-8-15(22)9-11-16)14-19(25)30-13-5-4-12-24-20(26)17-6-2-3-7-18(17)21(24)27/h2-3,6-11H,4-5,12-14H2,1H3 |
| InChIKey | SWCRCRADWRKGAB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate?
The IUPAC name of 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate (CID 31437953) is 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate.
What is the SMILES notation for 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate?
The canonical SMILES for 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate is CN(CC(=O)OCCCCN1C(=O)c2ccccc2C1=O)S(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate?
The InChIKey is SWCRCRADWRKGAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21FN2O6S/c1-23(31(28,29)16-10-8-15(22)9-11-16)14-19(25)30-13-5-4-12-24-20(26)17-6-2-3-7-18(17)21(24)27/h2-3,6-11H,4-5,12-14H2,1H3.
What are the key properties of 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate?
4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate has a molecular weight of 448.47 g/mol, XLogP of 2.07, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate is sourced from PubChem (CID 31437953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).