C16H15BrFNO4S — CID 55312041
(3-bromophenyl)methyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate (PubChem CID 55312041) has the molecular formula C16H15BrFNO4S and a molecular weight of 416.27 g/mol. Its IUPAC name is (3-bromophenyl)methyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate.
| Compound Name | (3-bromophenyl)methyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 55312041 |
| Molecular Formula | C16H15BrFNO4S |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | (3-bromophenyl)methyl 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OCc1cccc(Br)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15BrFNO4S/c1-19(24(21,22)15-7-5-14(18)6-8-15)10-16(20)23-11-12-3-2-4-13(17)9-12/h2-9H,10-11H2,1H3 |
| InChIKey | CHHNQTHILMZGLN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |