C31H34N2O5S — CID 19219107
N-(4-butylphenyl)-6-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)sulfonylhexanamide (PubChem CID 19219107) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol. Its IUPAC name is N-(4-butylphenyl)-6-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)sulfonylhexanamide.
| Compound Name | N-(4-butylphenyl)-6-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)sulfonylhexanamide |
|---|---|
| PubChem CID | 19219107 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | N-(4-butylphenyl)-6-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)sulfonylhexanamide |
| SMILES | CCCCc1ccc(N(C(=O)CCCCCN2C(=O)c3ccccc3C2=O)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H34N2O5S/c1-3-4-10-24-16-18-25(19-17-24)33(39(37,38)26-20-14-23(2)15-21-26)29(34)13-6-5-9-22-32-30(35)27-11-7-8-12-28(27)31(32)36/h7-8,11-12,14-21H,3-6,9-10,13,22H2,1-2H3 |
| InChIKey | KPWDVTKKWOMLGX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|