C12H12N2O7S — CID 174720230
methyl 2-[5-[methyl(sulfinooxy)amino]-1,3-dioxoisoindol-2-yl]acetate (PubChem CID 174720230) has the molecular formula C12H12N2O7S and a molecular weight of 328.30 g/mol. Its IUPAC name is methyl 2-[5-[methyl(sulfinooxy)amino]-1,3-dioxoisoindol-2-yl]acetate.
| Compound Name | methyl 2-[5-[methyl(sulfinooxy)amino]-1,3-dioxoisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 174720230 |
| Molecular Formula | C12H12N2O7S |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | methyl 2-[5-[methyl(sulfinooxy)amino]-1,3-dioxoisoindol-2-yl]acetate |
| SMILES | COC(=O)CN1C(=O)c2ccc(N(C)OS(=O)O)cc2C1=O |
| InChI | InChI=1S/C12H12N2O7S/c1-13(21-22(18)19)7-3-4-8-9(5-7)12(17)14(11(8)16)6-10(15)20-2/h3-5H,6H2,1-2H3,(H,18,19) |
| InChIKey | KYDUBMMNPCIMQO-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|