C15H19N3O6S — CID 86681711
2-[5-[2-(dimethylamino)ethyl-methylsulfonylamino]-1,3-dioxoisoindol-2-yl]acetic acid (PubChem CID 86681711) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-[5-[2-(dimethylamino)ethyl-methylsulfonylamino]-1,3-dioxoisoindol-2-yl]acetic acid.
| Compound Name | 2-[5-[2-(dimethylamino)ethyl-methylsulfonylamino]-1,3-dioxoisoindol-2-yl]acetic acid |
|---|---|
| PubChem CID | 86681711 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[5-[2-(dimethylamino)ethyl-methylsulfonylamino]-1,3-dioxoisoindol-2-yl]acetic acid |
| SMILES | CN(C)CCN(c1ccc2c(c1)C(=O)N(CC(=O)O)C2=O)S(C)(=O)=O |
| InChI | InChI=1S/C15H19N3O6S/c1-16(2)6-7-18(25(3,23)24)10-4-5-11-12(8-10)15(22)17(14(11)21)9-13(19)20/h4-5,8H,6-7,9H2,1-3H3,(H,19,20) |
| InChIKey | LTIZHUAFVPYSGR-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|