C14H16N2O4 — CID 9079192
2-[3-(dimethylamino)propyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 9079192) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[3-(dimethylamino)propyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 9079192 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[3-(dimethylamino)propyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | CN(C)CCCN1C(=O)c2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C14H16N2O4/c1-15(2)6-3-7-16-12(17)10-5-4-9(14(19)20)8-11(10)13(16)18/h4-5,8H,3,6-7H2,1-2H3,(H,19,20) |
| InChIKey | HJMMHOWUGMWLAP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|