C21H37NO7Si4 — CID 20750486
2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 20750486) has the molecular formula C21H37NO7Si4 and a molecular weight of 527.87 g/mol. Its IUPAC name is 2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 20750486 |
| Molecular Formula | C21H37NO7Si4 |
| Molecular Weight | 527.87 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCN1C(=O)c2ccc(C(=O)O)cc2C1=O)O[Si](C)(C)C |
| InChI | InChI=1S/C21H37NO7Si4/c1-30(2,3)27-32(7,8)29-33(9,28-31(4,5)6)14-10-13-22-19(23)17-12-11-16(21(25)26)15-18(17)20(22)24/h11-12,15H,10,13-14H2,1-9H3,(H,25,26) |
| InChIKey | SJILZTKUVFYEBE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.87 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|