C12H12N2O6S — CID 43546286
2-[2-(methanesulfonamido)ethyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 43546286) has the molecular formula C12H12N2O6S and a molecular weight of 312.30 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)ethyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[2-(methanesulfonamido)ethyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 43546286 |
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[2-(methanesulfonamido)ethyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | CS(=O)(=O)NCCN1C(=O)c2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C12H12N2O6S/c1-21(19,20)13-4-5-14-10(15)8-3-2-7(12(17)18)6-9(8)11(14)16/h2-3,6,13H,4-5H2,1H3,(H,17,18) |
| InChIKey | QMXZUFIATYENOP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|