4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid

C19H15NO5 — CID 755791

IUPAC4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid
SMILESCCCN1C(=O)c2ccc(C(=O)c3ccc(C(=O)O)cc3)cc2C1=O
InChIInChI=1S/C19H15NO5/c1-2-9-20-17(22)14-8-7-13(10-15(14)18(20)23)16(21)11-3-5-12(6-4-11)19(24)25/h3-8,10H,2,9H2,1H3,(H,24,25)
InChIKeyREZURHJGCPALBP-UHFFFAOYSA-N
MW337.33 g/mol
LogP2.62
Rot. Bonds5

About 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid

4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid (PubChem CID 755791) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid.

Molecular Properties

Compound Name4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid
PubChem CID755791
Molecular FormulaC19H15NO5
Molecular Weight337.33 g/mol
Exact Mass337.10
IUPAC Name4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid
SMILESCCCN1C(=O)c2ccc(C(=O)c3ccc(C(=O)O)cc3)cc2C1=O
InChIInChI=1S/C19H15NO5/c1-2-9-20-17(22)14-8-7-13(10-15(14)18(20)23)16(21)11-3-5-12(6-4-11)19(24)25/h3-8,10H,2,9H2,1H3,(H,24,25)
InChIKeyREZURHJGCPALBP-UHFFFAOYSA-N
XLogP2.62
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.33
LogP ≤ 52.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid?
The IUPAC name of 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid (CID 755791) is 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid.
What is the SMILES notation for 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid?
The canonical SMILES for 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid is CCCN1C(=O)c2ccc(C(=O)c3ccc(C(=O)O)cc3)cc2C1=O.
What is the InChIKey of 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid?
The InChIKey is REZURHJGCPALBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO5/c1-2-9-20-17(22)14-8-7-13(10-15(14)18(20)23)16(21)11-3-5-12(6-4-11)19(24)25/h3-8,10H,2,9H2,1H3,(H,24,25).
What are the key properties of 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid?
4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid has a molecular weight of 337.33 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid is sourced from PubChem (CID 755791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).