C19H15NO5 — CID 755791
4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid (PubChem CID 755791) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid.
| Compound Name | 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 755791 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-(1,3-dioxo-2-propylisoindole-5-carbonyl)benzoic acid |
| SMILES | CCCN1C(=O)c2ccc(C(=O)c3ccc(C(=O)O)cc3)cc2C1=O |
| InChI | InChI=1S/C19H15NO5/c1-2-9-20-17(22)14-8-7-13(10-15(14)18(20)23)16(21)11-3-5-12(6-4-11)19(24)25/h3-8,10H,2,9H2,1H3,(H,24,25) |
| InChIKey | REZURHJGCPALBP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|