C19H12N2O8 — CID 20667272
2-[[5-(hydroperoxymethyl)-1,3-dioxoisoindol-2-yl]methyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 20667272) has the molecular formula C19H12N2O8 and a molecular weight of 396.31 g/mol. Its IUPAC name is 2-[[5-(hydroperoxymethyl)-1,3-dioxoisoindol-2-yl]methyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[[5-(hydroperoxymethyl)-1,3-dioxoisoindol-2-yl]methyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 20667272 |
| Molecular Formula | C19H12N2O8 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-[[5-(hydroperoxymethyl)-1,3-dioxoisoindol-2-yl]methyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(CN1C(=O)c3ccc(COO)cc3C1=O)C2=O |
| InChI | InChI=1S/C19H12N2O8/c22-15-11-3-1-9(7-29-28)5-13(11)17(24)20(15)8-21-16(23)12-4-2-10(19(26)27)6-14(12)18(21)25/h1-6,28H,7-8H2,(H,26,27) |
| InChIKey | ZKGLPYCGUJSPQS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|