C26H16Br2O4Si — CID 20710016
3',7'-dibromo-7-(hydroperoxymethyl)-5,5'-spirobi[benzo[b][1]benzosilole]-3-carboxylic acid (PubChem CID 20710016) has the molecular formula C26H16Br2O4Si and a molecular weight of 580.30 g/mol. Its IUPAC name is 3',7'-dibromo-7-(hydroperoxymethyl)-5,5'-spirobi[benzo[b][1]benzosilole]-3-carboxylic acid.
| Compound Name | 3',7'-dibromo-7-(hydroperoxymethyl)-5,5'-spirobi[benzo[b][1]benzosilole]-3-carboxylic acid |
|---|---|
| PubChem CID | 20710016 |
| Molecular Formula | C26H16Br2O4Si |
| Molecular Weight | 580.30 g/mol |
| Exact Mass | 577.92 |
| IUPAC Name | 3',7'-dibromo-7-(hydroperoxymethyl)-5,5'-spirobi[benzo[b][1]benzosilole]-3-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)[Si]1(c3cc(Br)ccc3-c3ccc(Br)cc31)c1cc(COO)ccc1-2 |
| InChI | InChI=1S/C26H16Br2O4Si/c27-16-3-7-20-21-8-4-17(28)12-25(21)33(24(20)11-16)22-9-14(13-32-31)1-5-18(22)19-6-2-15(26(29)30)10-23(19)33/h1-12,31H,13H2,(H,29,30) |
| InChIKey | ZYBXCBYIMJYLMW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|