C26H14Br2O4Si — CID 23550299
3',7'-dibromo-5,5'-spirobi[benzo[b][1]benzosilole]-3,7-dicarboxylic acid (PubChem CID 23550299) has the molecular formula C26H14Br2O4Si and a molecular weight of 578.29 g/mol. Its IUPAC name is 3',7'-dibromo-5,5'-spirobi[benzo[b][1]benzosilole]-3,7-dicarboxylic acid.
| Compound Name | 3',7'-dibromo-5,5'-spirobi[benzo[b][1]benzosilole]-3,7-dicarboxylic acid |
|---|---|
| PubChem CID | 23550299 |
| Molecular Formula | C26H14Br2O4Si |
| Molecular Weight | 578.29 g/mol |
| Exact Mass | 575.90 |
| IUPAC Name | 3',7'-dibromo-5,5'-spirobi[benzo[b][1]benzosilole]-3,7-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)[Si]1(c3cc(Br)ccc3-c3ccc(Br)cc31)c1cc(C(=O)O)ccc1-2 |
| InChI | InChI=1S/C26H14Br2O4Si/c27-15-3-7-19-20-8-4-16(28)12-24(20)33(23(19)11-15)21-9-13(25(29)30)1-5-17(21)18-6-2-14(26(31)32)10-22(18)33/h1-12H,(H,29,30)(H,31,32) |
| InChIKey | QSVKWFBQELTQMF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|