C34H26N2O10 — CID 157428096
4-[5-(hydroperoxymethyl)-1,3-dioxoisoindol-2-yl]benzoic acid;5-(hydroperoxymethyl)-2-[4-[(E)-prop-1-enyl]phenyl]isoindole-1,3-dione (PubChem CID 157428096) has the molecular formula C34H26N2O10 and a molecular weight of 622.59 g/mol. Its IUPAC name is 4-[5-(hydroperoxymethyl)-1,3-dioxoisoindol-2-yl]benzoic acid;5-(hydroperoxymethyl)-2-[4-[(E)-prop-1-enyl]phenyl]isoindole-1,3-dione.
| Compound Name | 4-[5-(hydroperoxymethyl)-1,3-dioxoisoindol-2-yl]benzoic acid;5-(hydroperoxymethyl)-2-[4-[(E)-prop-1-enyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 157428096 |
| Molecular Formula | C34H26N2O10 |
| Molecular Weight | 622.59 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | 4-[5-(hydroperoxymethyl)-1,3-dioxoisoindol-2-yl]benzoic acid;5-(hydroperoxymethyl)-2-[4-[(E)-prop-1-enyl]phenyl]isoindole-1,3-dione |
| SMILES | C/C=C/c1ccc(N2C(=O)c3ccc(COO)cc3C2=O)cc1.O=C(O)c1ccc(N2C(=O)c3ccc(COO)cc3C2=O)cc1 |
| InChI | InChI=1S/C18H15NO4.C16H11NO6/c1-2-3-12-4-7-14(8-5-12)19-17(20)15-9-6-13(11-23-22)10-16(15)18(19)21;18-14-12-6-1-9(8-23-22)7-13(12)15(19)17(14)11-4-2-10(3-5-11)16(20)21/h2-10,22H,11H2,1H3;1-7,22H,8H2,(H,20,21)/b3-2+; |
| InChIKey | BQEVOZDTGRWOFP-SQQVDAMQSA-N |
| XLogP | 5.68 |
| TPSA | 170.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|