C34H18N2O8 — CID 46495419
2-[4-[(E)-4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenyl]but-1-en-3-ynyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 46495419) has the molecular formula C34H18N2O8 and a molecular weight of 582.52 g/mol. Its IUPAC name is 2-[4-[(E)-4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenyl]but-1-en-3-ynyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[4-[(E)-4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenyl]but-1-en-3-ynyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 46495419 |
| Molecular Formula | C34H18N2O8 |
| Molecular Weight | 582.52 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | 2-[4-[(E)-4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenyl]but-1-en-3-ynyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1ccc(C#C/C=C/c3ccc(N4C(=O)c5ccc(C(=O)O)cc5C4=O)cc3)cc1)C2=O |
| InChI | InChI=1S/C34H18N2O8/c37-29-25-15-9-21(33(41)42)17-27(25)31(39)35(29)23-11-5-19(6-12-23)3-1-2-4-20-7-13-24(14-8-20)36-30(38)26-16-10-22(34(43)44)18-28(26)32(36)40/h1,3,5-18H,(H,41,42)(H,43,44)/b3-1+ |
| InChIKey | USVDOOSSMUTTDX-HNQUOIGGSA-N |
| XLogP | 4.75 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|